C30H24N2O — CID 20821442
1-[3-[2-(3-methylphenyl)phenyl]-1,5-diphenylpyrazol-4-yl]ethanone (PubChem CID 20821442) has the molecular formula C30H24N2O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[3-[2-(3-methylphenyl)phenyl]-1,5-diphenylpyrazol-4-yl]ethanone.
| Compound Name | 1-[3-[2-(3-methylphenyl)phenyl]-1,5-diphenylpyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 20821442 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[3-[2-(3-methylphenyl)phenyl]-1,5-diphenylpyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(-c2ccccc2-c2cccc(C)c2)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H24N2O/c1-21-12-11-15-24(20-21)26-18-9-10-19-27(26)29-28(22(2)33)30(23-13-5-3-6-14-23)32(31-29)25-16-7-4-8-17-25/h3-20H,1-2H3 |
| InChIKey | RUSURCDPWPGNCR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |