C28H20N2O — CID 59163086
phenyl-(1,4,5-triphenylpyrazol-3-yl)methanone (PubChem CID 59163086) has the molecular formula C28H20N2O and a molecular weight of 400.48 g/mol. Its IUPAC name is phenyl-(1,4,5-triphenylpyrazol-3-yl)methanone.
| Compound Name | phenyl-(1,4,5-triphenylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 59163086 |
| Molecular Formula | C28H20N2O |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | phenyl-(1,4,5-triphenylpyrazol-3-yl)methanone |
| SMILES | O=C(c1ccccc1)c1nn(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H20N2O/c31-28(23-17-9-3-10-18-23)26-25(21-13-5-1-6-14-21)27(22-15-7-2-8-16-22)30(29-26)24-19-11-4-12-20-24/h1-20H |
| InChIKey | IQCVWVMBTOCYIF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |