C30H22N4O3 — CID 9498377
4-benzoyl-1,5-diphenyl-N-(phenylcarbamoyl)pyrazole-3-carboxamide (PubChem CID 9498377) has the molecular formula C30H22N4O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is 4-benzoyl-1,5-diphenyl-N-(phenylcarbamoyl)pyrazole-3-carboxamide.
| Compound Name | 4-benzoyl-1,5-diphenyl-N-(phenylcarbamoyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 9498377 |
| Molecular Formula | C30H22N4O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4-benzoyl-1,5-diphenyl-N-(phenylcarbamoyl)pyrazole-3-carboxamide |
| SMILES | O=C(NC(=O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C(=O)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C30H22N4O3/c35-28(22-15-7-2-8-16-22)25-26(29(36)32-30(37)31-23-17-9-3-10-18-23)33-34(24-19-11-4-12-20-24)27(25)21-13-5-1-6-14-21/h1-20H,(H2,31,32,36,37) |
| InChIKey | JXTUKYUGWKXINS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |