About 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide
5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide (PubChem CID 163894427) has the molecular formula C17H15N5O2
and a molecular weight of 321.34 g/mol. Its IUPAC name is 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide.
Molecular Properties
| Compound Name | 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide |
| PubChem CID | 163894427 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide |
| SMILES | NC(=O)c1c(C(=O)Nc2ccccc2)nn(-c2ccccc2)c1N |
| InChI | InChI=1S/C17H15N5O2/c18-15-13(16(19)23)14(17(24)20-11-7-3-1-4-8-11)21-22(15)12-9-5-2-6-10-12/h1-10H,18H2,(H2,19,23)(H,20,24) |
| InChIKey | QEJISJWQBGLVOC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide?
The IUPAC name of 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide (CID 163894427) is 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide.
What is the SMILES notation for 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide?
The canonical SMILES for 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide is NC(=O)c1c(C(=O)Nc2ccccc2)nn(-c2ccccc2)c1N.
What is the InChIKey of 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide?
The InChIKey is QEJISJWQBGLVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O2/c18-15-13(16(19)23)14(17(24)20-11-7-3-1-4-8-11)21-22(15)12-9-5-2-6-10-12/h1-10H,18H2,(H2,19,23)(H,20,24).
What are the key properties of 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide?
5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide has a molecular weight of 321.34 g/mol, XLogP of 1.81, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-N,1-diphenylpyrazole-3,4-dicarboxamide is sourced from PubChem (CID 163894427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).