C18H13N5OS2 — CID 135747033
N,1-diphenyl-4,6-bis(sulfanylidene)-7H-pyrazolo[5,4-d]pyrimidine-3-carboxamide (PubChem CID 135747033) has the molecular formula C18H13N5OS2 and a molecular weight of 379.47 g/mol. Its IUPAC name is N,1-diphenyl-4,6-bis(sulfanylidene)-7H-pyrazolo[5,4-d]pyrimidine-3-carboxamide.
| Compound Name | N,1-diphenyl-4,6-bis(sulfanylidene)-7H-pyrazolo[5,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 135747033 |
| Molecular Formula | C18H13N5OS2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N,1-diphenyl-4,6-bis(sulfanylidene)-7H-pyrazolo[5,4-d]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nn(-c2ccccc2)c2[nH]c(=S)[nH]c(=S)c12 |
| InChI | InChI=1S/C18H13N5OS2/c24-16(19-11-7-3-1-4-8-11)14-13-15(20-18(26)21-17(13)25)23(22-14)12-9-5-2-6-10-12/h1-10H,(H,19,24)(H2,20,21,25,26) |
| InChIKey | KZVOMWYGKBHAQP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|