C35H26N8O6S2 — CID 129010796
4-benzoyl-1-[4-[(2E)-2-(1,3-dioxo-1-phenylbutan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 129010796) has the molecular formula C35H26N8O6S2 and a molecular weight of 718.78 g/mol. Its IUPAC name is 4-benzoyl-1-[4-[(2E)-2-(1,3-dioxo-1-phenylbutan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | 4-benzoyl-1-[4-[(2E)-2-(1,3-dioxo-1-phenylbutan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129010796 |
| Molecular Formula | C35H26N8O6S2 |
| Molecular Weight | 718.78 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | 4-benzoyl-1-[4-[(2E)-2-(1,3-dioxo-1-phenylbutan-2-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | CC(=O)/C(=N\Nc1ccc(-n2nc(C(=O)Nc3nnc(S(N)(=O)=O)s3)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H26N8O6S2/c1-21(44)28(32(46)24-15-9-4-10-16-24)39-38-25-17-19-26(20-18-25)43-30(22-11-5-2-6-12-22)27(31(45)23-13-7-3-8-14-23)29(42-43)33(47)37-34-40-41-35(50-34)51(36,48)49/h2-20,38H,1H3,(H2,36,48,49)(H,37,40,47)/b39-28+ |
| InChIKey | IWUWDOWIUKXRIA-MULCNKJOSA-N |
| XLogP | 4.76 |
| TPSA | 208.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|