C30H24N8O6S2 — CID 52914669
4-benzoyl-1-[4-[2-(2,4-dioxopentan-3-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 52914669) has the molecular formula C30H24N8O6S2 and a molecular weight of 656.71 g/mol. Its IUPAC name is 4-benzoyl-1-[4-[2-(2,4-dioxopentan-3-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | 4-benzoyl-1-[4-[2-(2,4-dioxopentan-3-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 52914669 |
| Molecular Formula | C30H24N8O6S2 |
| Molecular Weight | 656.71 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | 4-benzoyl-1-[4-[2-(2,4-dioxopentan-3-ylidene)hydrazinyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | CC(=O)C(=NNc1ccc(-n2nc(C(=O)Nc3nnc(S(N)(=O)=O)s3)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1)C(C)=O |
| InChI | InChI=1S/C30H24N8O6S2/c1-17(39)24(18(2)40)34-33-21-13-15-22(16-14-21)38-26(19-9-5-3-6-10-19)23(27(41)20-11-7-4-8-12-20)25(37-38)28(42)32-29-35-36-30(45-29)46(31,43)44/h3-16,33H,1-2H3,(H2,31,43,44)(H,32,35,42) |
| InChIKey | KMCLUNNYLBDUMH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 208.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|