C31H22N8O5S2 — CID 135878387
4-benzoyl-1-[3-[(4-hydroxyphenyl)diazenyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 135878387) has the molecular formula C31H22N8O5S2 and a molecular weight of 650.70 g/mol. Its IUPAC name is 4-benzoyl-1-[3-[(4-hydroxyphenyl)diazenyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | 4-benzoyl-1-[3-[(4-hydroxyphenyl)diazenyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135878387 |
| Molecular Formula | C31H22N8O5S2 |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.12 |
| IUPAC Name | 4-benzoyl-1-[3-[(4-hydroxyphenyl)diazenyl]phenyl]-5-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)c2nn(-c3cccc(/N=N/c4ccc(O)cc4)c3)c(-c3ccccc3)c2C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C31H22N8O5S2/c32-46(43,44)31-37-36-30(45-31)33-29(42)26-25(28(41)20-10-5-2-6-11-20)27(19-8-3-1-4-9-19)39(38-26)23-13-7-12-22(18-23)35-34-21-14-16-24(40)17-15-21/h1-18,40H,(H2,32,43,44)(H,33,36,42)/b35-34+ |
| InChIKey | XWOCEZSKLHXLBX-XAHDOWKMSA-N |
| XLogP | 5.64 |
| TPSA | 194.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|