C12H9N5O5S2 — CID 54705989
4-hydroxy-2-oxo-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-1H-quinoline-3-carboxamide (PubChem CID 54705989) has the molecular formula C12H9N5O5S2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-1H-quinoline-3-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 54705989 |
| Molecular Formula | C12H9N5O5S2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 4-hydroxy-2-oxo-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-1H-quinoline-3-carboxamide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)c2c(O)c3ccccc3[nH]c2=O)s1 |
| InChI | InChI=1S/C12H9N5O5S2/c13-24(21,22)12-17-16-11(23-12)15-10(20)7-8(18)5-3-1-2-4-6(5)14-9(7)19/h1-4H,(H2,13,21,22)(H2,14,18,19)(H,15,16,20) |
| InChIKey | ZJIMCYQNBWUTQD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|