C18H14N2O4 — CID 54693736
N-(4-acetylphenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 54693736) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 54693736 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(4-acetylphenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2c(O)c3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H14N2O4/c1-10(21)11-6-8-12(9-7-11)19-17(23)15-16(22)13-4-2-3-5-14(13)20-18(15)24/h2-9H,1H3,(H,19,23)(H2,20,22,24) |
| InChIKey | CKFJNNLLEOYKPV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |