C10H7NO4 — CID 54697499
4-hydroxy-2-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 54697499) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 4-hydroxy-2-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54697499 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 4-hydroxy-2-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c(O)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C10H7NO4/c12-8-5-3-1-2-4-6(5)11-9(13)7(8)10(14)15/h1-4H,(H,14,15)(H2,11,12,13) |
| InChIKey | JEBJIWLJHQOTIA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |