C4H8N6O3S2 — CID 130452184
2,2-diamino-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 130452184) has the molecular formula C4H8N6O3S2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 2,2-diamino-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2,2-diamino-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 130452184 |
| Molecular Formula | C4H8N6O3S2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2,2-diamino-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | NC(N)C(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C4H8N6O3S2/c5-1(6)2(11)8-3-9-10-4(14-3)15(7,12)13/h1H,5-6H2,(H2,7,12,13)(H,8,9,11) |
| InChIKey | XXJUHOQHABPLIB-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|