C6H8N4O6S2 — CID 71341876
2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]butanedioic acid (PubChem CID 71341876) has the molecular formula C6H8N4O6S2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]butanedioic acid.
| Compound Name | 2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]butanedioic acid |
|---|---|
| PubChem CID | 71341876 |
| Molecular Formula | C6H8N4O6S2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]butanedioic acid |
| SMILES | NS(=O)(=O)c1nnc(NC(CC(=O)O)C(=O)O)s1 |
| InChI | InChI=1S/C6H8N4O6S2/c7-18(15,16)6-10-9-5(17-6)8-2(4(13)14)1-3(11)12/h2H,1H2,(H,8,9)(H,11,12)(H,13,14)(H2,7,15,16) |
| InChIKey | HWJDPPYLWOQIAL-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 172.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |