C5H7ClN4O3S2 — CID 54476371
3-chloro-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 54476371) has the molecular formula C5H7ClN4O3S2 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-chloro-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-chloro-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 54476371 |
| Molecular Formula | C5H7ClN4O3S2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 3-chloro-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)CCCl)s1 |
| InChI | InChI=1S/C5H7ClN4O3S2/c6-2-1-3(11)8-4-9-10-5(14-4)15(7,12)13/h1-2H2,(H2,7,12,13)(H,8,9,11) |
| InChIKey | XLWGIGRCWQCUAC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|