C6H10N6O4S2 — CID 10827620
2-amino-N-[2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]acetamide (PubChem CID 10827620) has the molecular formula C6H10N6O4S2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 10827620 |
| Molecular Formula | C6H10N6O4S2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C6H10N6O4S2/c7-1-3(13)9-2-4(14)10-5-11-12-6(17-5)18(8,15)16/h1-2,7H2,(H,9,13)(H2,8,15,16)(H,10,11,14) |
| InChIKey | OYAOKYMFRYPRMN-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|