C7H14N6O5S3 — CID 101078048
3-(dimethylsulfamoylamino)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 101078048) has the molecular formula C7H14N6O5S3 and a molecular weight of 358.43 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(dimethylsulfamoylamino)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 101078048 |
| Molecular Formula | C7H14N6O5S3 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CN(C)S(=O)(=O)NCCC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H14N6O5S3/c1-13(2)21(17,18)9-4-3-5(14)10-6-11-12-7(19-6)20(8,15)16/h9H,3-4H2,1-2H3,(H2,8,15,16)(H,10,11,14) |
| InChIKey | VQGDAYBWCIRURC-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 164.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|