C6H11N7O3S2 — CID 10062976
2-[carbamimidoyl(methyl)amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 10062976) has the molecular formula C6H11N7O3S2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[carbamimidoyl(methyl)amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 10062976 |
| Molecular Formula | C6H11N7O3S2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | [H]/N=C(\N)N(C)CC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C6H11N7O3S2/c1-13(4(7)8)2-3(14)10-5-11-12-6(17-5)18(9,15)16/h2H2,1H3,(H3,7,8)(H2,9,15,16)(H,10,11,14) |
| InChIKey | UGKZABQBFUBOFG-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|