C11H17N5O3S — CID 10637879
2-[carbamimidoyl(methyl)amino]-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 10637879) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-[carbamimidoyl(methyl)amino]-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10637879 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)N(C)CC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H17N5O3S/c1-16(11(12)13)7-10(17)15-6-8-2-4-9(5-3-8)20(14,18)19/h2-5H,6-7H2,1H3,(H3,12,13)(H,15,17)(H2,14,18,19) |
| InChIKey | DAPNTAAOHWTXCR-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|