C11H16N4O4S — CID 10756624
2-amino-N-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]acetamide (PubChem CID 10756624) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 10756624 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16N4O4S/c12-5-10(16)15-7-11(17)14-6-8-1-3-9(4-2-8)20(13,18)19/h1-4H,5-7,12H2,(H,14,17)(H,15,16)(H2,13,18,19) |
| InChIKey | SAHGEZSCUXWMSX-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |