C10H15N5O4S — CID 10804238
2-amino-N-[2-oxo-2-[2-(4-sulfamoylphenyl)hydrazinyl]ethyl]acetamide (PubChem CID 10804238) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[2-(4-sulfamoylphenyl)hydrazinyl]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-[2-(4-sulfamoylphenyl)hydrazinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 10804238 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[2-(4-sulfamoylphenyl)hydrazinyl]ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NNc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15N5O4S/c11-5-9(16)13-6-10(17)15-14-7-1-3-8(4-2-7)20(12,18)19/h1-4,14H,5-6,11H2,(H,13,16)(H,15,17)(H2,12,18,19) |
| InChIKey | FKIFGIZHFPIJND-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|