C12H18N4O4S — CID 60848496
2-amino-N-[2-(2,3-dimethyl-5-sulfamoylanilino)-2-oxoethyl]acetamide (PubChem CID 60848496) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-amino-N-[2-(2,3-dimethyl-5-sulfamoylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-(2,3-dimethyl-5-sulfamoylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60848496 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-amino-N-[2-(2,3-dimethyl-5-sulfamoylanilino)-2-oxoethyl]acetamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)CN)c1C |
| InChI | InChI=1S/C12H18N4O4S/c1-7-3-9(21(14,19)20)4-10(8(7)2)16-12(18)6-15-11(17)5-13/h3-4H,5-6,13H2,1-2H3,(H,15,17)(H,16,18)(H2,14,19,20) |
| InChIKey | YIFHLSYTBWUDIE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |