C14H17N3O5S3 — CID 55678440
N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 55678440) has the molecular formula C14H17N3O5S3 and a molecular weight of 403.51 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 55678440 |
| Molecular Formula | C14H17N3O5S3 |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)CNS(=O)(=O)c2cccs2)c1C |
| InChI | InChI=1S/C14H17N3O5S3/c1-9-6-11(24(15,19)20)7-12(10(9)2)17-13(18)8-16-25(21,22)14-4-3-5-23-14/h3-7,16H,8H2,1-2H3,(H,17,18)(H2,15,19,20) |
| InChIKey | XKGSTJSSIKJQNX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |