C14H14N2O4S2 — CID 15995650
N-(4-acetylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 15995650) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 15995650 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-(4-acetylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CNS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H14N2O4S2/c1-10(17)11-4-6-12(7-5-11)16-13(18)9-15-22(19,20)14-3-2-8-21-14/h2-8,15H,9H2,1H3,(H,16,18) |
| InChIKey | QKMJCJUHWGTBAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |