C20H24N2O4S2 — CID 15989581
N-(4-acetylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide (PubChem CID 15989581) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 15989581 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-(4-acetylphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C2CCC(CNS(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-14(23)16-8-10-18(11-9-16)22-20(24)17-6-4-15(5-7-17)13-21-28(25,26)19-3-2-12-27-19/h2-3,8-12,15,17,21H,4-7,13H2,1H3,(H,22,24) |
| InChIKey | OHQVLAQELJUSCJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |