C9H13NO3S2 — CID 66006317
N-[(3-hydroxycyclobutyl)methyl]thiophene-2-sulfonamide (PubChem CID 66006317) has the molecular formula C9H13NO3S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66006317 |
| Molecular Formula | C9H13NO3S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CC(O)C1)c1cccs1 |
| InChI | InChI=1S/C9H13NO3S2/c11-8-4-7(5-8)6-10-15(12,13)9-2-1-3-14-9/h1-3,7-8,10-11H,4-6H2 |
| InChIKey | HRWCGJHFQSJVIP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |