C16H26N4O3S2 — CID 97274825
N-[[(3R)-1-(4-methylpiperazine-1-carbonyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide (PubChem CID 97274825) has the molecular formula C16H26N4O3S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[[(3R)-1-(4-methylpiperazine-1-carbonyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[(3R)-1-(4-methylpiperazine-1-carbonyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 97274825 |
| Molecular Formula | C16H26N4O3S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[[(3R)-1-(4-methylpiperazine-1-carbonyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide |
| SMILES | CN1CCN(C(=O)N2CCC[C@@H](CNS(=O)(=O)c3cccs3)C2)CC1 |
| InChI | InChI=1S/C16H26N4O3S2/c1-18-7-9-19(10-8-18)16(21)20-6-2-4-14(13-20)12-17-25(22,23)15-5-3-11-24-15/h3,5,11,14,17H,2,4,6-10,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | UYPZGZLDEINNBS-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |