C20H22N4O4S2 — CID 45207609
N-[[1-(2-quinazolin-4-yloxyacetyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide (PubChem CID 45207609) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[[1-(2-quinazolin-4-yloxyacetyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[1-(2-quinazolin-4-yloxyacetyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 45207609 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[[1-(2-quinazolin-4-yloxyacetyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide |
| SMILES | O=C(COc1ncnc2ccccc12)N1CCCC(CNS(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C20H22N4O4S2/c25-18(13-28-20-16-6-1-2-7-17(16)21-14-22-20)24-9-3-5-15(12-24)11-23-30(26,27)19-8-4-10-29-19/h1-2,4,6-8,10,14-15,23H,3,5,9,11-13H2 |
| InChIKey | YLQACEAKRCSBGU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |