C18H24N2O3S3 — CID 45252310
N-[[1-(4-thiophen-2-ylbutanoyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide (PubChem CID 45252310) has the molecular formula C18H24N2O3S3 and a molecular weight of 412.60 g/mol. Its IUPAC name is N-[[1-(4-thiophen-2-ylbutanoyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[1-(4-thiophen-2-ylbutanoyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 45252310 |
| Molecular Formula | C18H24N2O3S3 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[[1-(4-thiophen-2-ylbutanoyl)piperidin-3-yl]methyl]thiophene-2-sulfonamide |
| SMILES | O=C(CCCc1cccs1)N1CCCC(CNS(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H24N2O3S3/c21-17(8-1-6-16-7-3-11-24-16)20-10-2-5-15(14-20)13-19-26(22,23)18-9-4-12-25-18/h3-4,7,9,11-12,15,19H,1-2,5-6,8,10,13-14H2 |
| InChIKey | VZXGYZZBCQZFQN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |