C12H20ClN3O3S2 — CID 119491037
N-[2-[3-(methylamino)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride (PubChem CID 119491037) has the molecular formula C12H20ClN3O3S2 and a molecular weight of 353.90 g/mol. Its IUPAC name is N-[2-[3-(methylamino)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[2-[3-(methylamino)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119491037 |
| Molecular Formula | C12H20ClN3O3S2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[2-[3-(methylamino)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride |
| SMILES | CNC1CCCN(C(=O)CNS(=O)(=O)c2cccs2)C1.Cl |
| InChI | InChI=1S/C12H19N3O3S2.ClH/c1-13-10-4-2-6-15(9-10)11(16)8-14-20(17,18)12-5-3-7-19-12;/h3,5,7,10,13-14H,2,4,6,8-9H2,1H3;1H |
| InChIKey | CSLKDPZQZBSYFP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |