C12H18ClN3O3S2 — CID 120658920
N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride (PubChem CID 120658920) has the molecular formula C12H18ClN3O3S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120658920 |
| Molecular Formula | C12H18ClN3O3S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.O=C(CNS(=O)(=O)c1cccs1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C12H17N3O3S2.ClH/c16-11(15-7-9-4-13-5-10(9)8-15)6-14-20(17,18)12-2-1-3-19-12;/h1-3,9-10,13-14H,4-8H2;1H/t9-,10+; |
| InChIKey | GWWAGTXPOOJZRQ-JMVWIVNTSA-N |
| XLogP | 0.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |