C16H18FN3O3S2 — CID 5183080
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide (PubChem CID 5183080) has the molecular formula C16H18FN3O3S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 5183080 |
| Molecular Formula | C16H18FN3O3S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H18FN3O3S2/c17-13-3-5-14(6-4-13)19-7-9-20(10-8-19)15(21)12-18-25(22,23)16-2-1-11-24-16/h1-6,11,18H,7-10,12H2 |
| InChIKey | IQPJZFFECSRXFN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |