C18H29N3O6S2 — CID 172910139
N-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]thiophene-2-sulfonamide;formic acid (PubChem CID 172910139) has the molecular formula C18H29N3O6S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]thiophene-2-sulfonamide;formic acid.
| Compound Name | N-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]thiophene-2-sulfonamide;formic acid |
|---|---|
| PubChem CID | 172910139 |
| Molecular Formula | C18H29N3O6S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]thiophene-2-sulfonamide;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CNS(=O)(=O)c3cccs3)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C17H27N3O4S2.CH2O2/c1-19(2)14-7-12-10-20(11-13(12)8-15(14)24-3)16(21)9-18-26(22,23)17-5-4-6-25-17;2-1-3/h4-6,12-15,18H,7-11H2,1-3H3;1H,(H,2,3)/t12-,13+,14-,15-;/m1./s1 |
| InChIKey | JVUDZWRPRXFSKW-XKKAXVAMSA-N |
| XLogP | 0.54 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|