C23H36N2O4 — CID 172896534
1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-phenylpentan-1-one;formic acid (PubChem CID 172896534) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-phenylpentan-1-one;formic acid.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-phenylpentan-1-one;formic acid |
|---|---|
| PubChem CID | 172896534 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5-phenylpentan-1-one;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CCCCc3ccccc3)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C22H34N2O2.CH2O2/c1-23(2)20-13-18-15-24(16-19(18)14-21(20)26-3)22(25)12-8-7-11-17-9-5-4-6-10-17;2-1-3/h4-6,9-10,18-21H,7-8,11-16H2,1-3H3;1H,(H,2,3)/t18-,19+,20-,21-;/m1./s1 |
| InChIKey | KLROQUJPLWRNOO-YMFSJSFGSA-N |
| XLogP | 2.91 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|