C27H36N2O4 — CID 172911477
1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3,3-diphenylpropan-1-one;formic acid (PubChem CID 172911477) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3,3-diphenylpropan-1-one;formic acid.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3,3-diphenylpropan-1-one;formic acid |
|---|---|
| PubChem CID | 172911477 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3,3-diphenylpropan-1-one;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CC(c3ccccc3)c3ccccc3)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C26H34N2O2.CH2O2/c1-27(2)24-14-21-17-28(18-22(21)15-25(24)30-3)26(29)16-23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;2-1-3/h4-13,21-25H,14-18H2,1-3H3;1H,(H,2,3)/t21-,22+,24-,25-;/m1./s1 |
| InChIKey | WKMPQEMGQBLXIG-HXVAEXSLSA-N |
| XLogP | 3.72 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|