C24H33N3O2 — CID 172667388
1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-indol-1-ylethanone (PubChem CID 172667388) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-indol-1-ylethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-indol-1-ylethanone |
|---|---|
| PubChem CID | 172667388 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-indol-1-ylethanone |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)Cn3ccc4ccccc43)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-25(2)22-11-19-13-27(14-20(19)12-23(22)29-16-17-7-8-17)24(28)15-26-10-9-18-5-3-4-6-21(18)26/h3-6,9-10,17,19-20,22-23H,7-8,11-16H2,1-2H3/t19-,20+,22-,23-/m1/s1 |
| InChIKey | SMCHOIUFNCBDFI-IRMYBRCSSA-N |
| XLogP | 3.24 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |