C25H38N4O2 — CID 172663089
[6-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 172663089) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is [6-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [6-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 172663089 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | [6-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(c3ccc(C(=O)N4CCCCC4)cn3)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C25H38N4O2/c1-27(2)22-12-20-15-29(16-21(20)13-23(22)31-17-18-6-7-18)24-9-8-19(14-26-24)25(30)28-10-4-3-5-11-28/h8-9,14,18,20-23H,3-7,10-13,15-17H2,1-2H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | NMQCCWIBWJUOEU-KAOXLYBCSA-N |
| XLogP | 3.28 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |