C25H39N5O2 — CID 172667929
[2-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 172667929) has the molecular formula C25H39N5O2 and a molecular weight of 441.62 g/mol. Its IUPAC name is [2-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 172667929 |
| Molecular Formula | C25H39N5O2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | [2-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccnc(N3C[C@H]4C[C@@H](N(C)C)[C@H](OCC5CC5)C[C@H]4C3)c2)CC1 |
| InChI | InChI=1S/C25H39N5O2/c1-27(2)22-12-20-15-30(16-21(20)13-23(22)32-17-18-4-5-18)24-14-19(6-7-26-24)25(31)29-10-8-28(3)9-11-29/h6-7,14,18,20-23H,4-5,8-13,15-17H2,1-3H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | ICLLBQQGWNFXBC-KAOXLYBCSA-N |
| XLogP | 2.04 |
| TPSA | 52.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |