C16H20N2O — CID 110702436
2-indol-1-yl-1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 110702436) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-indol-1-yl-1-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-indol-1-yl-1-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 110702436 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-indol-1-yl-1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCN(C(=O)Cn2ccc3ccccc32)C1 |
| InChI | InChI=1S/C16H20N2O/c1-13-5-4-9-18(11-13)16(19)12-17-10-8-14-6-2-3-7-15(14)17/h2-3,6-8,10,13H,4-5,9,11-12H2,1H3 |
| InChIKey | FXYLBOPBMWRPLP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |