C17H21N3O3 — CID 74249344
1-(4-acetyl-6-hydroxy-1,4-diazepan-1-yl)-2-indol-1-ylethanone (PubChem CID 74249344) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(4-acetyl-6-hydroxy-1,4-diazepan-1-yl)-2-indol-1-ylethanone.
| Compound Name | 1-(4-acetyl-6-hydroxy-1,4-diazepan-1-yl)-2-indol-1-ylethanone |
|---|---|
| PubChem CID | 74249344 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-(4-acetyl-6-hydroxy-1,4-diazepan-1-yl)-2-indol-1-ylethanone |
| SMILES | CC(=O)N1CCN(C(=O)Cn2ccc3ccccc32)CC(O)C1 |
| InChI | InChI=1S/C17H21N3O3/c1-13(21)18-8-9-20(11-15(22)10-18)17(23)12-19-7-6-14-4-2-3-5-16(14)19/h2-7,15,22H,8-12H2,1H3 |
| InChIKey | UMYORJPRIFDAFS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |