C19H25N3O2 — CID 95759248
1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-indol-1-ylethanone (PubChem CID 95759248) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-indol-1-ylethanone.
| Compound Name | 1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-indol-1-ylethanone |
|---|---|
| PubChem CID | 95759248 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-indol-1-ylethanone |
| SMILES | O=C(Cn1ccc2ccccc21)N1CCN([C@@H]2CCC[C@@H]2O)CC1 |
| InChI | InChI=1S/C19H25N3O2/c23-18-7-3-6-17(18)20-10-12-21(13-11-20)19(24)14-22-9-8-15-4-1-2-5-16(15)22/h1-2,4-5,8-9,17-18,23H,3,6-7,10-14H2/t17-,18+/m1/s1 |
| InChIKey | IOGNDGYVBZZZMY-MSOLQXFVSA-N |
| XLogP | 1.70 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |