C20H27NO2 — CID 101189458
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-indol-1-ylacetate (PubChem CID 101189458) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-indol-1-ylacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-indol-1-ylacetate |
|---|---|
| PubChem CID | 101189458 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-indol-1-ylacetate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C20H27NO2/c1-14(2)17-9-8-15(3)12-19(17)23-20(22)13-21-11-10-16-6-4-5-7-18(16)21/h4-7,10-11,14-15,17,19H,8-9,12-13H2,1-3H3/t15-,17?,19-/m1/s1 |
| InChIKey | SYNDCDVVEBNNLM-WUKPUPCQSA-N |
| XLogP | 4.65 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |