C23H33N2O2+ — CID 129230805
[(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(E)-prop-1-enyl]benzimidazol-3-ium-1-yl]acetate (PubChem CID 129230805) has the molecular formula C23H33N2O2+ and a molecular weight of 369.53 g/mol. Its IUPAC name is [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(E)-prop-1-enyl]benzimidazol-3-ium-1-yl]acetate.
| Compound Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(E)-prop-1-enyl]benzimidazol-3-ium-1-yl]acetate |
|---|---|
| PubChem CID | 129230805 |
| Molecular Formula | C23H33N2O2+ |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(E)-prop-1-enyl]benzimidazol-3-ium-1-yl]acetate |
| SMILES | C/C=C/c1n(CC(=O)O[C@@H]2C[C@H](C)CCC2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C23H33N2O2/c1-6-9-22-24(5)19-10-7-8-11-20(19)25(22)15-23(26)27-21-14-17(4)12-13-18(21)16(2)3/h6-11,16-18,21H,12-15H2,1-5H3/q+1/b9-6+/t17-,18?,21-/m1/s1 |
| InChIKey | PPTOEHLECYVKNA-AGPWZYSVSA-N |
| XLogP | 4.50 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|