C27H35IN2O2 — CID 159217590
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-(3-methylphenyl)benzimidazol-3-ium-1-yl]acetate iodide (PubChem CID 159217590) has the molecular formula C27H35IN2O2 and a molecular weight of 546.49 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-(3-methylphenyl)benzimidazol-3-ium-1-yl]acetate iodide.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-(3-methylphenyl)benzimidazol-3-ium-1-yl]acetate iodide |
|---|---|
| PubChem CID | 159217590 |
| Molecular Formula | C27H35IN2O2 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-(3-methylphenyl)benzimidazol-3-ium-1-yl]acetate iodide |
| SMILES | Cc1cccc(-c2n(CC(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)C)c3ccccc3[n+]2C)c1.[I-] |
| InChI | InChI=1S/C27H35N2O2.HI/c1-18(2)22-14-13-20(4)16-25(22)31-26(30)17-29-24-12-7-6-11-23(24)28(5)27(29)21-10-8-9-19(3)15-21;/h6-12,15,18,20,22,25H,13-14,16-17H2,1-5H3;1H/q+1;/p-1/t20-,22+,25-;/m1./s1 |
| InChIKey | MGCSRTDTTGMUSH-NQIUFZONSA-M |
| XLogP | 2.45 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|