C28H37N2O3+ — CID 129374865
[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate (PubChem CID 129374865) has the molecular formula C28H37N2O3+ and a molecular weight of 449.62 g/mol. Its IUPAC name is [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate.
| Compound Name | [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate |
|---|---|
| PubChem CID | 129374865 |
| Molecular Formula | C28H37N2O3+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate |
| SMILES | Cc1cccc(OCc2n(CC(=O)O[C@@H]3C[C@@H](C)CC[C@H]3C(C)C)c3ccccc3[n+]2C)c1 |
| InChI | InChI=1S/C28H37N2O3/c1-19(2)23-14-13-21(4)16-26(23)33-28(31)17-30-25-12-7-6-11-24(25)29(5)27(30)18-32-22-10-8-9-20(3)15-22/h6-12,15,19,21,23,26H,13-14,16-18H2,1-5H3/q+1/t21-,23-,26+/m0/s1 |
| InChIKey | UMEWCIAJSNIUJY-RZPFDVGOSA-N |
| XLogP | 5.36 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|