C28H39ClN2O3 — CID 23724249
decyl 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate chloride (PubChem CID 23724249) has the molecular formula C28H39ClN2O3 and a molecular weight of 487.08 g/mol. Its IUPAC name is decyl 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate chloride.
| Compound Name | decyl 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate chloride |
|---|---|
| PubChem CID | 23724249 |
| Molecular Formula | C28H39ClN2O3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | decyl 2-[3-methyl-2-[(3-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate chloride |
| SMILES | CCCCCCCCCCOC(=O)Cn1c(COc2cccc(C)c2)[n+](C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C28H39N2O3.ClH/c1-4-5-6-7-8-9-10-13-19-32-28(31)21-30-26-18-12-11-17-25(26)29(3)27(30)22-33-24-16-14-15-23(2)20-24;/h11-12,14-18,20H,4-10,13,19,21-22H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BAXOHKAJCQANSC-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|