C13H17N2O2+ — CID 3560881
ethyl 2-(2,3-dimethylbenzimidazol-3-ium-1-yl)acetate (PubChem CID 3560881) has the molecular formula C13H17N2O2+ and a molecular weight of 233.29 g/mol. Its IUPAC name is ethyl 2-(2,3-dimethylbenzimidazol-3-ium-1-yl)acetate.
| Compound Name | ethyl 2-(2,3-dimethylbenzimidazol-3-ium-1-yl)acetate |
|---|---|
| PubChem CID | 3560881 |
| Molecular Formula | C13H17N2O2+ |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | ethyl 2-(2,3-dimethylbenzimidazol-3-ium-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(C)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C13H17N2O2/c1-4-17-13(16)9-15-10(2)14(3)11-7-5-6-8-12(11)15/h5-8H,4,9H2,1-3H3/q+1 |
| InChIKey | XYCJBYNQNFLTBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|