C13H18N3O2+ — CID 3380342
ethyl 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)acetate (PubChem CID 3380342) has the molecular formula C13H18N3O2+ and a molecular weight of 248.31 g/mol. Its IUPAC name is ethyl 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)acetate.
| Compound Name | ethyl 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 3380342 |
| Molecular Formula | C13H18N3O2+ |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethyl 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)acetate |
| SMILES | CCOC(=O)C[n+]1c(N)n(CC)c2ccccc21 |
| InChI | InChI=1S/C13H17N3O2/c1-3-15-10-7-5-6-8-11(10)16(13(15)14)9-12(17)18-4-2/h5-8,14H,3-4,9H2,1-2H3/p+1 |
| InChIKey | ASKCCXNUNOWUMW-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|