C18H20N3O+ — CID 4172537
2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone (PubChem CID 4172537) has the molecular formula C18H20N3O+ and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone.
| Compound Name | 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 4172537 |
| Molecular Formula | C18H20N3O+ |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone |
| SMILES | CCn1c(N)[n+](CC(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H19N3O/c1-3-20-15-6-4-5-7-16(15)21(18(20)19)12-17(22)14-10-8-13(2)9-11-14/h4-11,19H,3,12H2,1-2H3/p+1 |
| InChIKey | NBGGTZSABUHPTR-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|