C18H22BrN3O — CID 44659633
1-ethyl-3-[2-(4-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine bromide (PubChem CID 44659633) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine bromide.
| Compound Name | 1-ethyl-3-[2-(4-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 44659633 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine bromide |
| SMILES | CCn1c(N)[n+](CCOc2ccc(C)cc2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C18H21N3O.BrH/c1-3-20-16-6-4-5-7-17(16)21(18(20)19)12-13-22-15-10-8-14(2)9-11-15;/h4-11,19H,3,12-13H2,1-2H3;1H |
| InChIKey | RPQLVMYDHAYKTM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 44.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|