C26H30N3O2+ — CID 123132589
1-[3-(4-methylphenoxy)propyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine (PubChem CID 123132589) has the molecular formula C26H30N3O2+ and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[3-(4-methylphenoxy)propyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine.
| Compound Name | 1-[3-(4-methylphenoxy)propyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine |
|---|---|
| PubChem CID | 123132589 |
| Molecular Formula | C26H30N3O2+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-[3-(4-methylphenoxy)propyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine |
| SMILES | Cc1ccc(OCCC[n+]2c(N)n(CCCOc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-21-13-15-23(16-14-21)31-20-8-18-29-25-12-6-5-11-24(25)28(26(29)27)17-7-19-30-22-9-3-2-4-10-22/h2-6,9-16,27H,7-8,17-20H2,1H3/p+1 |
| InChIKey | RZSQFKZCTJVIOF-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|